CAS 152006-17-2

2,3-O-Isopropylidene-L-lyxono-1,4-lactone

Description:

2,3-O-Isopropylidene-L-lyxono-1,4-lactone is a chemical compound characterized by its lactone structure, which is a cyclic ester formed from the condensation of a hydroxy acid. This compound features an isopropylidene group, which contributes to its stability and solubility properties. It is derived from L-lyxonoic acid, a sugar acid, and exhibits chirality due to the presence of multiple stereocenters. The lactone form typically indicates that the compound can participate in various chemical reactions, including hydrolysis and esterification. Its molecular structure allows for potential applications in organic synthesis, particularly in the preparation of other carbohydrate derivatives or as intermediates in the synthesis of pharmaceuticals. The compound is likely to be soluble in organic solvents, and its stability can be influenced by factors such as temperature and pH. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment.

Formula: C₈H₁₂O₅

InChI: InChI=1/C8H12O5/c1-8(2)12-5-4(3-9)11-7(10)6(5)13-8/h4-6,9H,3H2,1-2H3/t4-,5?,6?/m0/s1

SMILES: CC1(C)OC2[C@H](CO)OC(=O)C2O1

(3aR,6S,6aR)-6-(Hydroxymethyl)-2,2-dimethyldihydrofuro[3,4-d][1,3]dioxol-4(3aH)-one

CAS: 152006-17-2

(3aR,6S,6aR)-6-(Hydroxymethyl)-2,2-dimethyldihydrofuro[3,4-d][1,3]dioxol-4(3aH)-one

Purity: 95%

Molecular weight: 188.18g/mol

Ref: 54-OR1064196

2,3-O-Isopropylidene-L-lyxono-1,4-lactone

CAS: 152006-17-2

Molecular weight: 188.18

Ref: 7W-GC3580

2,3-O-Isopropylidene-L-lyxonolactone

CAS: 152006-17-2

2,3-O-Isopropylidene-L-lyxonolactone is a Carbohydrate.

Formula: C₈H₁₂O₅

Color and Shape: Solid

Molecular weight: 188.18

Ref: TM-TNU0692

2,3-O-Isopropylidene-L-lyxonic acid-1,4-lactone

CAS: 152006-17-2

2,3-O-Isopropylidene-L-lyxonic acid-1,4-lactone is an enantiopure compound that is a member of the glycoside family. It has been shown to inhibit the activity of glycosidases, which are enzymes that hydrolyze glycosides. 2,3-O-Isopropylidene-L-lyxonic acid-1,4-lactone has an ambiguous stereochemistry due to its carbon chains and catalytic groups. The conformational analysis of this compound reveals that it can be classified as a chiral molecule because it lacks a plane of symmetry. Crystallographic analysis has shown that 2,3-O-Isopropylidene-L-lyxonic acid-1,4-lactone adopts a dimeric form and crystallizes in an asymmetric unit cell with space group P2(1)22(1).

Formula: C₈H₁₂O₅

Purity: Min. 97 Area-%

Color and Shape: White Powder

Molecular weight: 188.18 g/mol

Ref: 3D-MI04767

2,3-O-Isopropylidene-L-lyxono-1,4-lactone

Controlled Product

CAS: 152006-17-2

Formula: C₈H₁₂O₅

Color and Shape: Neat

Molecular weight: 188.18

Ref: TR-I868650