CAS 15205-19-3

1-(2,6-dichlorophenyl)-N-methylmethanamine

Description:

1-(2,6-Dichlorophenyl)-N-methylmethanamine, with the CAS number 15205-19-3, is an organic compound characterized by its amine functional group and a dichlorophenyl substituent. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its structural properties that may influence biological activity. The presence of the dichlorophenyl group suggests that it may exhibit significant hydrophobic characteristics, which can affect its solubility and interaction with biological membranes. Additionally, the methyl group attached to the nitrogen atom can influence the compound's basicity and reactivity. Safety data indicates that, like many amines, it may pose risks such as skin and eye irritation, and appropriate handling precautions should be observed. Overall, this compound's unique structure contributes to its potential utility in synthetic chemistry and medicinal applications.

Formula: C₈H₉Cl₂N

InChI: InChI=1/C8H9Cl2N/c1-11-5-6-7(9)3-2-4-8(6)10/h2-4,11H,5H2,1H3

SMILES: CNCc1c(cccc1Cl)Cl

Synonyms:

• [(2,6-Dichlorophenyl)Methyl](Methyl)Amine
• Benzenemethanamine, 2,6-dichloro-N-methyl-

N-(2,6-Dichlorobenzyl)-N-methylamine

CAS: 15205-19-3

N-(2,6-Dichlorobenzyl)-N-methylamine

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 190.07g/mol

Ref: 54-OR110982

1-(2,6-Dichlorophenyl)-N-methylmethanamine

CAS: 15205-19-3

Formula: C₈H₉Cl₂N

Purity: 95.0%

Molecular weight: 190.07

Ref: 10-F440510

N-(2,6-Dichlorobenzyl)-N-methylamine

CAS: 15205-19-3

N-(2,6-Dichlorobenzyl)-N-methylamine is a colorless liquid with the chemical formula C8H9Cl2N. It is used as a solvent for extraction, and has been shown to be an experimental anti-cancer drug candidate in screening tests. The two chlorines on the benzyl group are electron withdrawing groups that form hydrogen bonds with water molecules. This compound is a carboxylic acid that can interact with other carboxylic acids to form salts or esters. N-(2,6-Dichlorobenzyl)-N-methylamine has the potential to cause environmental damage, although this has not been definitively established.

Formula: C₈H₉Cl₂N

Purity: Min. 95%

Molecular weight: 190.07 g/mol

Ref: 3D-QAA20519