CAS 15205-27-3
:N-(1,3-BENZODIOXOL-5-YLMETHYL)-N-METHYLAMINE
Description:
N-(1,3-Benzodioxol-5-ylmethyl)-N-methylamine, identified by its CAS number 15205-27-3, is an organic compound characterized by its unique structure that includes a benzodioxole moiety and a methylamine group. This compound typically exhibits properties associated with both aromatic and amine functionalities, which can influence its reactivity and solubility. The presence of the benzodioxole ring suggests potential applications in medicinal chemistry, particularly in the development of psychoactive substances or pharmaceuticals, as this structure is often found in various bioactive compounds. The methylamine component contributes to its basicity and potential for forming salts. In terms of physical properties, it may be a colorless to light yellow liquid or solid, depending on its purity and specific conditions. Its behavior in chemical reactions can be influenced by the electron-donating nature of the benzodioxole group, making it a candidate for further study in organic synthesis and pharmacology. Safety and handling precautions should be observed due to its potential biological activity.
Formula:C9H12NO2
InChI:InChI=1/C9H11NO2/c1-10-5-7-2-3-8-9(4-7)12-6-11-8/h2-4,10H,5-6H2,1H3/p+1
Synonyms:- Chembrdg-Bb 4015017
- 1-(1,3-Benzodioxol-5-Yl)-N-Methylmethanamine
- 1,3-benzodioxol-5-yl-N-methylmethanaminium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(Benzo[d][1,3]dioxol-5-yl)-N-methylmethanamine
CAS:Formula:C9H11NO2Purity:97%Color and Shape:LiquidMolecular weight:165.1891(1,3-Dioxaindan-5-ylmethyl)(methyl)amine
CAS:(1,3-Dioxaindan-5-ylmethyl)(methyl)aminePurity:97%Molecular weight:165.19g/mol(1,3-Benzodioxol-5-ylmethyl)methylamine hydrochloride
CAS:Controlled Product(1,3-Benzodioxol-5-ylmethyl)methylamine hydrochloride (BZMA) is a drug that has been used in research to study the role of serotonin in psychological effects and as a marker for fingerprinting. BZMA is a synthetic compound that is structurally similar to drugs like amphetamine and MDMA. It is not known to have any recreational use. BZMA can be detected using matrix-assisted laser desorption/ionization mass spectrometry. This technique requires a sample containing less than 1% impurities, which are usually silicon compounds or other ions.Formula:C9H11NO2Purity:Min. 95%Molecular weight:165.19 g/mol



