
CAS 1521-02-4
:2,5-Bis(dimethylamino)-2,5-cyclohexadiene-1,4-dione
Description:
2,5-Bis(dimethylamino)-2,5-cyclohexadiene-1,4-dione, also known as "DMBAC," is an organic compound characterized by its unique structure that features a cyclohexadiene core with two dimethylamino groups and diketone functionalities. This compound typically appears as a solid or crystalline substance and is known for its vibrant color, often exhibiting shades of yellow to orange. It is soluble in polar organic solvents, which facilitates its use in various chemical reactions and applications. The presence of the dimethylamino groups contributes to its basicity and reactivity, making it a useful intermediate in organic synthesis, particularly in the production of dyes and pigments. Additionally, the diketone moiety can participate in various chemical transformations, including condensation and cyclization reactions. Due to its structural features, this compound may also exhibit interesting electronic properties, making it a subject of study in materials science and organic electronics. Safety precautions should be observed when handling this substance, as it may pose health risks upon exposure.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c1-11(2)7-5-10(14)8(12(3)4)6-9(7)13/h5-6H,1-4H3
InChI key:InChIKey=BZZIJKWURTYMLH-UHFFFAOYSA-N
SMILES:N(C)(C)C=1C(=O)C=C(N(C)C)C(=O)C1
Synonyms:- p-Benzoquinone, 2,5-bis(dimethylamino)-
- 2,5-Bis(dimethylamino)-1,4-benzoquinone
- 2,5-Cyclohexadiene-1,4-dione, 2,5-bis(dimethylamino)-
- 2,5-Bis(dimethylamino)-p-benzoquinone
- 2,5-Bis(dimethylamino)-2,5-cyclohexadiene-1,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
