CAS 15210-60-3
:3,5,7-Trimethyl-1-adamantanamine hydrochloride (1:1)
Description:
3,5,7-Trimethyl-1-adamantanamine hydrochloride is a chemical compound characterized by its adamantane structure, which is a polycyclic hydrocarbon known for its stability and unique three-dimensional shape. This compound features three methyl groups attached to the adamantane framework, specifically at the 3, 5, and 7 positions, contributing to its steric and electronic properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and facilitates its use in various applications. The amine functional group in its structure suggests potential biological activity, making it of interest in medicinal chemistry. Its properties may include moderate to high melting points and specific solubility characteristics, influenced by the presence of the hydrochloride moiety. Overall, 3,5,7-Trimethyl-1-adamantanamine hydrochloride is notable for its structural complexity and potential utility in pharmaceutical research and development.
Formula:C13H24ClN
InChI:InChI=1S/C13H23N.ClH/c1-10-4-11(2)6-12(3,5-10)9-13(14,7-10)8-11;/h4-9,14H2,1-3H3;1H
SMILES:CC12CC3(C)CC(C)(C1)CC(C2)(C3)N.Cl
Synonyms:- 3,5,7-Trimethyl-1-adamantanamine hydrochloride
- Tricyclo[3.3.1.13,7]decan-1-amine, 3,5,7-trimethyl-, hydrochloride (1:1)
- Tricyclo[3.3.1.13,7]decan-1-amine, 3,5,7-trimethyl-, hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Memantine Related Compound H (3,5,7-Trimethyladamantan-1-amine hydrochloride)
CAS:Cyclanic, cyclenic or cycloterpenic mono- or polyamines, and their derivatives; salts thereofFormula:C13H23N·HClColor and Shape:White PowderMolecular weight:229.15973(3,5,7-trimethyl-1-adamantyl)amine hydrochloride
CAS:Formula:C13H24ClNPurity:97%Color and Shape:SolidMolecular weight:229.78943,5,7-Trimethyladamantan-1-amine hydrochloride
CAS:3,5,7-Trimethyladamantan-1-amine hydrochloridePurity:98%Memantine EP Impurity B HCl (Memantine USP Related Compound H)
CAS:Formula:C13H23N·HClColor and Shape:White To Off-White SolidMolecular weight:193.33 36.467-Methyl Memantine Hydrochloride
CAS:Stability Hygroscopic
Applications 7-Methyl Memantine is an impurity of Memantine (HCl salt, M218000) which is used as an antiparkinsonian and antispasmodic.
References Rohde, H., et al.: Fortschr. Med., 100, 2023 (1982), Kornhuber, J., et al.: Eur. J. Pharmacol., 166, 589 (1989), Gortelmeyer, R. and Erbler, H.: Arzneimittel-Forsch., 42, 904 (1992)Formula:C13H23N·ClHColor and Shape:White SolidMolecular weight:229.79(3,5,7-trimethyl-1-adamantyl)amine hydrochloride
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:229.78999328613283,5,7-Trimethyl-1-aminoadamantane hydrochloride
CAS:3,5,7-Trimethyl-1-aminoadamantane hydrochloride is a versatile building block that can be used in the production of various fine chemicals. 3,5,7-Trimethyl-1-aminoadamantane hydrochloride is a reagent and speciality chemical that has been used as a research chemical in the synthesis of complex compounds. It is also a useful building block for the synthesis of high quality reaction components and scaffolds.Formula:C13H23N•HClPurity:Min. 95%Color and Shape:White PowderMolecular weight:229.79 g/mol










