CAS 152100-45-3
:((S)-(-)-1-(4-NITROPHENYL)-2-PYRROLIDIN&
Description:
The chemical substance known as ((S)-(-)-1-(4-nitrophenyl)-2-pyrrolidin) is a chiral compound characterized by its specific stereochemistry, indicated by the (S) configuration. This compound features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a nitrophenyl group, which contributes to its electronic properties and potential reactivity. The presence of the nitro group (-NO2) on the phenyl ring enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The chirality of this compound suggests that it may exhibit different biological activities depending on its stereoisomer, which is significant in pharmaceutical applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it important for applications in organic synthesis and medicinal chemistry. Overall, ((S)-(-)-1-(4-nitrophenyl)-2-pyrrolidin) is a notable compound in the realm of organic chemistry, particularly for its potential applications in drug development and synthesis.
Formula:C14H16N2O4
InChI:InChI=1/C14H16N2O4/c1-2-14(17)20-10-13-4-3-9-15(13)11-5-7-12(8-6-11)16(18)19/h2,5-8,13H,1,3-4,9-10H2/t13-/m0/s1
SMILES:C=CC(=O)OC[C@@H]1CCCN1c1ccc(cc1)N(=O)=O
Synonyms:- Npp Acrylate
- [(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]methyl prop-2-enoate
- ((S)-(-)-1-(4-NITROPHENYL)-2-PYRROLIDIN&
- (S)-(-)-1-(4-Nitrophenyl)-2-pyrrolidinemethyl]acrylate 97%
- 2-Propenoic acid, [(2S)-1-(4-nitrophenyl)-2-pyrrolidinyl]methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.