CymitQuimica logo

CAS 152126-33-5

:

4-Fluoro-3-pyridinecarboxylic acid

Description:
4-Fluoro-3-pyridinecarboxylic acid is an aromatic carboxylic acid featuring a pyridine ring substituted with a fluorine atom and a carboxylic acid group. Its molecular structure includes a pyridine ring, which is a six-membered heterocyclic compound containing one nitrogen atom, and the carboxylic acid functional group (-COOH) positioned at the 3-carbon relative to the nitrogen. The presence of the fluorine atom at the 4-position enhances the compound's reactivity and can influence its physical and chemical properties, such as solubility and acidity. This compound is typically a white to off-white solid and is soluble in polar solvents like water and alcohols. It may exhibit moderate to high acidity due to the carboxylic acid group, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, its unique structure allows for potential interactions in biological systems, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H4FNO2
InChI:InChI=1S/C6H4FNO2/c7-5-1-2-8-3-4(5)6(9)10/h1-3H,(H,9,10)
InChI key:InChIKey=UBIVUIKWHBNGFG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(F)=CC=NC1
Synonyms:
  • 3-Pyridinecarboxylic acid, 4-fluoro-
  • 3-Pyridinecarboxylicacid,4-fluoro-(9CI)
  • 4-Fluoro-3-pyridinecarboxylic acid
  • 4-Fluoropyridine-3-Carboxylic Acid
  • 4-Fluoropyridine-3-Carboxylic Acid 98%
  • 4-Fluoropyridine-3-carboxylicacid98%
Found 3 products.