CymitQuimica logo

CAS 152149-07-0

:

2-(quinolin-7-yl)acetic acid

Description:
2-(Quinolin-7-yl)acetic acid is an organic compound characterized by its quinoline moiety, which contributes to its aromatic properties and potential biological activity. This compound features a carboxylic acid functional group, which imparts acidic characteristics and enhances its solubility in polar solvents. The presence of the quinoline ring, a bicyclic structure containing a nitrogen atom, suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure allows for various functionalization possibilities, which can be explored for the development of derivatives with enhanced pharmacological properties. Additionally, the compound's unique structure may influence its reactivity, solubility, and interaction with other chemical species, making it a subject of interest in both synthetic and medicinal chemistry research. Overall, 2-(quinolin-7-yl)acetic acid represents a versatile scaffold for further exploration in drug development and chemical synthesis.
Formula:C11H9NO2
InChI:InChI=1/C11H9NO2/c13-11(14)7-8-3-4-9-2-1-5-12-10(9)6-8/h1-6H,7H2,(H,13,14)
SMILES:c1cc2ccc(cc2nc1)CC(=O)O
Synonyms:
  • 7-Quinolineacetic Acid
  • Quinolin-7-ylacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.