CAS 152152-09-5
:trans-2,6-Difluorocinnamic acid
Description:
Trans-2,6-Difluorocinnamic acid is an organic compound characterized by its unique structure, which includes a cinnamic acid backbone with two fluorine substituents at the 2 and 6 positions of the aromatic ring. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and materials science due to its interesting chemical properties. The presence of fluorine atoms can enhance lipophilicity and influence the compound's reactivity, making it a subject of interest in medicinal chemistry. Trans-2,6-Difluorocinnamic acid exhibits typical characteristics of carboxylic acids, such as the ability to form hydrogen bonds and participate in acid-base reactions. Its trans configuration contributes to its stability and affects its physical properties, including melting point and solubility. Additionally, the compound may exhibit specific optical activity due to its chiral centers, which can be relevant in the development of enantiomerically pure substances for therapeutic use. Overall, trans-2,6-Difluorocinnamic acid is a valuable compound for research and development in various chemical fields.
Formula:C9H5F2O2
InChI:InChI=1/C9H6F2O2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/p-1/b5-4+
Synonyms:- (2E)-3-(2,6-Difluorophenyl)-2-propenoic acid
- Rarechem Bk Hw 0116
- Timtec-Bb Sbb006676
- trans-2,6-Difluorocinnamicacid
- 3-(2,6-Difluoro-Phenyl)-Acrylic Acid
- 2,6-Difluorocinnamic acid
- 1,1'-(1,1,1,3,3,3-Hexafluoropropane-2,2-Diyl)Bis(4-Isocyanatobenzene)
- (2E)-3-(2,6-difluorophenyl)prop-2-enoic acid
- (2E)-3-(2,6-difluorophenyl)prop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,6-Difluorocinnamic acid
CAS:Formula:C9H6F2O2Purity:95%Color and Shape:SolidMolecular weight:184.13953-(2,6-Difluorophenyl)acrylic acid
CAS:3-(2,6-Difluorophenyl)acrylic acidPurity:98%Molecular weight:184.14g/mol



