CAS 1521601-27-3

Methyl 1-[(2-chloroacetyl)amino]cyclopropanecarboxylate

Description:

Methyl 1-[(2-chloroacetyl)amino]cyclopropanecarboxylate is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and an acetamide functional group. This compound features a methyl ester group, contributing to its reactivity and solubility in organic solvents. The presence of the chloroacetyl moiety introduces electrophilic characteristics, making it potentially useful in various synthetic applications, particularly in medicinal chemistry. The cyclopropane ring adds strain, which can enhance reactivity in certain chemical reactions. Additionally, the compound may exhibit biological activity due to its structural components, making it a candidate for further pharmacological studies. Its molecular interactions can be influenced by the presence of the chlorine atom, which can affect polarity and hydrogen bonding capabilities. Overall, Methyl 1-[(2-chloroacetyl)amino]cyclopropanecarboxylate is a versatile compound with potential applications in organic synthesis and drug development.

Formula: C₇H₁₀ClNO₃

InChI: InChI=1S/C7H10ClNO3/c1-12-6(11)7(2-3-7)9-5(10)4-8/h2-4H2,1H3,(H,9,10)

InChI key: InChIKey=ZMCWCMPFSWMBGH-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)C1(C(OC)=O)CC1

Synonyms:

• Cyclopropanecarboxylic acid, 1-[(2-chloroacetyl)amino]-, methyl ester
• Methyl 1-[(2-chloroacetyl)amino]cyclopropanecarboxylate

Methyl 1-(2-chloroacetamido)cyclopropane-1-carboxylate

CAS: 1521601-27-3

Versatile small molecule scaffold

Formula: C₇H₁₀ClNO₃

Purity: Min. 95%

Molecular weight: 191.61 g/mol

Ref: 3D-WKC60127