CAS 152167-85-6
:5-Fluoro-8-Nitro Quinoline
Description:
5-Fluoro-8-nitroquinoline is a synthetic organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a fluorine atom at the 5-position and a nitro group at the 8-position contributes to its unique chemical properties and reactivity. This compound is typically a yellow to orange solid and is sparingly soluble in water but more soluble in organic solvents. It exhibits notable biological activity, making it of interest in medicinal chemistry, particularly for its potential as an antimicrobial or anticancer agent. The nitro group can undergo reduction, leading to various derivatives, while the fluorine atom can influence the compound's lipophilicity and metabolic stability. As with many nitro-containing compounds, it is essential to handle 5-fluoro-8-nitroquinoline with care due to potential toxicity and environmental concerns. Overall, its distinct structural features and biological relevance make it a subject of ongoing research in the fields of pharmaceuticals and organic synthesis.
Formula:C9H5FN2O2
InChI:InChI=1/C9H5FN2O2/c10-7-3-4-8(12(13)14)9-6(7)2-1-5-11-9/h1-5H
SMILES:c1cc2c(ccc(c2nc1)N(=O)=O)F
Synonyms:- Quinoline, 5-fluoro-8-nitro-
- 5-Fluoro-8-nitroquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
5-Fluoro-8-nitroquinoline
CAS:Controlled Product<p>Applications 5-Fluoro-8-nitroquinoline (cas# 152167-85-6) is a useful research chemical.<br></p>Formula:C9H5FN2O2Color and Shape:NeatMolecular weight:192.147



