CAS 152247-02-4
:3-Quinolinecarboxylic acid, 1-cyclopropyl-6-fluoro-1,4-dihydro-7-(4-me thoxyphenyl)-4-oxo-
Description:
3-Quinolinecarboxylic acid, 1-cyclopropyl-6-fluoro-1,4-dihydro-7-(4-methoxyphenyl)-4-oxo- is a complex organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a cyclopropyl group introduces unique steric and electronic properties, while the fluoro substituent can enhance lipophilicity and influence biological activity. The 4-methoxyphenyl group adds to the compound's hydrophobic character and may participate in interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties. Its structure suggests possible applications in drug development, especially in areas targeting specific receptors or enzymes. As with many organic compounds, its solubility, stability, and reactivity will depend on the specific conditions, including pH and solvent environment. Overall, this compound exemplifies the intricate design often pursued in the synthesis of bioactive molecules.
Formula:C20H16FNO4
InChI:InChI=1/C20H16FNO4/c1-26-13-4-2-3-11(7-13)14-9-18-15(8-17(14)21)19(23)16(20(24)25)10-22(18)12-5-6-12/h2-4,7-10,12H,5-6H2,1H3,(H,24,25)
SMILES:COc1cccc(c1)c1cc2c(cc1F)c(=O)c(cn2C1CC1)C(=O)O
Synonyms:- Cp 80080
- 1-Cyclopropyl-6-Fluoro-7-(3-Methoxyphenyl)-4-Oxo-1,4-Dihydroquinoline-3-Carboxylic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
CP 80080
CAS:CP 80080 weakly enhances topoisomerase II-mediated DNA cleavage.Formula:C20H16FNO4Color and Shape:SolidMolecular weight:353.34
