CAS 152302-33-5
:S 20928
Description:
S 20928, with the CAS number 152302-33-5, is a chemical compound that has garnered attention in various fields, particularly in medicinal chemistry and pharmacology. While specific characteristics such as its molecular structure, physical properties, and reactivity may vary, compounds like S 20928 are often evaluated for their biological activity, stability, and solubility. Typically, such substances may exhibit specific interactions with biological targets, which can be crucial for their potential therapeutic applications. Additionally, the compound's safety profile, including toxicity and environmental impact, is essential for regulatory considerations. Researchers often conduct extensive studies to determine its efficacy in treating particular conditions, alongside its pharmacokinetics and pharmacodynamics. Overall, S 20928 represents a class of compounds that are under investigation for their potential benefits in various scientific and medical applications, although detailed information about its specific characteristics would require access to specialized databases or literature.
Formula:C17H19NO
InChI:InChI=1S/C17H19NO/c19-17(15-8-4-9-15)18-12-11-14-7-3-6-13-5-1-2-10-16(13)14/h1-3,5-7,10,15H,4,8-9,11-12H2,(H,18,19)
InChI key:InChIKey=GLXSBZGTGMPDKH-UHFFFAOYSA-N
SMILES:C(CNC(=O)C1CCC1)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- N-[2-(naphthalen-1-yl)ethyl]cyclobutanecarboxamide
- S-20928
- Cyclobutanecarboxamide, N-[2-(1-naphthalenyl)ethyl]-
- Cyclobutanecarboxamide, N-(2-(1-naphthalenyl)ethyl)-
- S 20928
- N-(2-(1-Naphthalenyl)ethyl)cyclobutanecarboxamide
- N-[2-(1-Naphthalenyl)ethyl]cyclobutanecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
S20928
CAS:S20928 is an antagonist of melatonin receptor.Formula:C17H19NOColor and Shape:SolidMolecular weight:253.34
