
CAS 152305-53-8
:myo-Inositol, 1-[3-(4-methoxyspiro[1,2-dioxetane-3,2′-tricyclo[3.3.1.13,7]decan]-4-yl)phenyl hydrogen phosphate]
Description:
Myo-Inositol, 1-[3-(4-methoxyspiro[1,2-dioxetane-3,2′-tricyclo[3.3.1.13,7]decan]-4-yl)phenyl hydrogen phosphate], identified by CAS number 152305-53-8, is a complex organic compound characterized by its unique structural features. It contains a myo-inositol backbone, which is a cyclic sugar alcohol known for its role in cellular signaling and osmoregulation. The presence of a phenyl hydrogen phosphate group indicates potential reactivity and biological activity, particularly in phosphorylation processes. The spiro[1,2-dioxetane] moiety contributes to its stability and may influence its photochemical properties, making it of interest in various applications, including biochemistry and medicinal chemistry. The methoxy group enhances its solubility and may affect its interaction with biological targets. Overall, this compound's intricate structure suggests potential utility in research related to cell signaling, drug development, and possibly as a fluorescent probe due to the dioxetane component. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C24H33O12P
InChI:InChI=1S/C24H33O12P/c1-32-24(23(35-36-24)14-6-11-5-12(8-14)9-15(23)7-11)13-3-2-4-16(10-13)33-37(30,31)34-22-20(28)18(26)17(25)19(27)21(22)29/h2-4,10-12,14-15,17-22,25-29H,5-9H2,1H3,(H,30,31)
InChI key:InChIKey=FGAATWUKMRDHGX-UHFFFAOYSA-N
SMILES:O(C)C1(C2(C3CC4CC2CC(C3)C4)OO1)C5=CC(OP(OC6C(O)C(O)C(O)C(O)C6O)(=O)O)=CC=C5
Synonyms:- myo-Inositol, 1-[3-(4-methoxyspiro[1,2-dioxetane-3,2′-tricyclo[3.3.1.13,7]decan]-4-yl)phenyl hydrogen phosphate]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lumi-PI
CAS:Lumi-PI is used as a chemiluminescent substrate for detecting phosphatidylinositol-specific phospholipase C.Formula:C24H33O12PColor and Shape:SolidMolecular weight:544.49
