CAS 15231-48-8

2-HYDROXY-4-METHYLPYRIMIDINE

Description:

2-Hydroxy-4-methylpyrimidine, with the CAS number 15231-48-8, is an organic compound belonging to the pyrimidine family, characterized by a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a hydroxyl group (-OH) at the 2-position and a methyl group (-CH3) at the 4-position, which contribute to its chemical reactivity and solubility properties. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxyl group. The compound exhibits potential biological activity, making it of interest in pharmaceutical and agricultural research. Its structure allows for hydrogen bonding, which can influence its interactions with other molecules. Additionally, 2-hydroxy-4-methylpyrimidine can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₅H₆N₂O

InChI: InChI=1/C5H6N2O/c1-4-2-3-6-5(8)7-4/h2-3H,1H3,(H,6,7,8)

SMILES: Cc1ccnc(n1)O

Synonyms:

• 2(1H)-Pyrimidinone, 4-methyl- (8CI,9CI)
• 4-Methylpyrimidin-2-One
• 6-methylpyrimidin-2(1H)-one

4-Methyl-1,2-dihydropyrimidin-2-one

CAS: 15231-48-8

Formula: C₅H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 110.1139

Ref: IN-DA006U3E

4-Methylpyrimidin-2(1H)-one

CAS: 15231-48-8

4-Methylpyrimidin-2(1H)-one

Purity: 95%

Molecular weight: 110.12g/mol

Ref: 54-OR1052778

4-Methylpyrimidin-2-ol

CAS: 15231-48-8

Formula: C₅H₆N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 110.116

Ref: 10-F077800

2-Hydroxy-4-methylpyrimidine

CAS: 15231-48-8

2-Hydroxy-4-methylpyrimidine is a heterocyclic compound that is used in the synthesis of other heterocycles. It is prepared by the reaction of methylbenzene and nitrous acid, followed by hydrolysis to form an imine. This compound has been synthesized with various substituents at different positions on the ring and also as a series of homologues. The 2-hydroxy-4-methylpyrimidine molecule has four nitroso groups, which are substituted with methyl groups. X-ray crystallography studies have shown that the molecule can exist in two different forms: one with the methyl groups pointing "homotopically" towards each other and the other with them directed "heterotopically."

Formula: C₅H₆N₂O

Purity: Min. 95%

Molecular weight: 110.11 g/mol

Ref: 3D-FH09750