CAS 15233-35-9
:N-(1,6-Dihydro-4-methyl-6-oxo-2-pyrimidinyl)-N′-(4-methylphenyl)guanidine
Description:
N-(1,6-Dihydro-4-methyl-6-oxo-2-pyrimidinyl)-N′-(4-methylphenyl)guanidine, identified by its CAS number 15233-35-9, is a chemical compound that belongs to the class of guanidines. This substance features a pyrimidine ring, which contributes to its heterocyclic nature, and is substituted with both a methyl group and a phenyl group, enhancing its lipophilicity and potential biological activity. The presence of the guanidine functional group suggests that it may exhibit basic properties, which can influence its solubility and reactivity in various environments. This compound may be of interest in pharmaceutical research due to its structural characteristics, which could be linked to specific biological activities or mechanisms of action. Additionally, its unique molecular structure may allow for interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. However, detailed studies would be necessary to fully elucidate its properties, potential applications, and safety profile.
Formula:C13H15N5O
InChI:InChI=1S/C13H15N5O/c1-8-3-5-10(6-4-8)16-12(14)18-13-15-9(2)7-11(19)17-13/h3-7H,1-2H3,(H4,14,15,16,17,18,19)
InChI key:InChIKey=NKSDQMJJJDHSNF-UHFFFAOYSA-N
SMILES:N(C(NC1=CC=C(C)C=C1)=N)C=2NC(C)=CC(=O)N2
Synonyms:- N-(1,6-Dihydro-4-methyl-6-oxo-2-pyrimidinyl)-N′-(4-methylphenyl)guanidine
- 2-(6-Methyl-4-oxo-1H-pyrimidin-2-yl)-1-(4-methylphenyl)guanidine
- Guanidine, 1-(4-hydroxy-6-methyl-2-pyrimidinyl)-3-p-tolyl-
- Guanidine, N-(1,6-dihydro-4-methyl-6-oxo-2-pyrimidinyl)-N′-(4-methylphenyl)-
- Guanidine, N-(1,4-dihydro-6-methyl-4-oxo-2-pyrimidinyl)-N′-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.