CAS 152342-26-2

(2-benzyl-1H-benzimidazol-1-yl)acetic acid

Description:

(2-benzyl-1H-benzimidazol-1-yl)acetic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole moiety and an acetic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the benzimidazole ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. It may display moderate solubility in organic solvents and varying solubility in water, influenced by the presence of the carboxylic acid group. The compound's molecular structure allows for potential hydrogen bonding, which can affect its reactivity and interactions in biological systems. Additionally, it may possess acidic properties due to the carboxylic acid group, which can participate in proton transfer reactions. Overall, (2-benzyl-1H-benzimidazol-1-yl)acetic acid is a compound of interest for further research, particularly in the fields of pharmacology and organic synthesis.

Formula: C₁₆H₁₄N₂O₂

InChI: InChI=1/C16H14N2O2/c19-16(20)11-18-14-9-5-4-8-13(14)17-15(18)10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H,19,20)

SMILES: c1ccc(cc1)Cc1nc2ccccc2n1CC(=O)O

Synonyms:

• 1H-3,1-benzimidazolium, 1-(carboxymethyl)-2-(phenylmethyl)-, inner salt
• 1H-benzimidazole-1-acetic acid, 2-(phenylmethyl)-

(2-Benzyl-1H-benzimidazol-1-yl)acetic acid

Controlled Product

CAS: 152342-26-2

Versatile small molecule scaffold

Formula: C₁₆H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 266.29 g/mol

Ref: 3D-CGA34226