CAS 15235-99-1
:7-HYDROXY-5-METHYLFLAVONE
Description:
7-Hydroxy-5-methylflavone, with the CAS number 15235-99-1, is a flavonoid compound characterized by its polyphenolic structure, which includes a chromone backbone. This compound features a hydroxyl group at the 7-position and a methyl group at the 5-position of the flavone structure, contributing to its unique chemical properties and potential biological activities. It is known for its antioxidant properties, which can help in scavenging free radicals and reducing oxidative stress. Additionally, flavonoids like 7-hydroxy-5-methylflavone are often studied for their potential anti-inflammatory, antimicrobial, and anticancer effects. The compound is typically soluble in organic solvents and may exhibit varying solubility in water, depending on pH and other conditions. Its structural characteristics allow it to interact with various biological targets, making it a subject of interest in pharmacological research. Overall, 7-hydroxy-5-methylflavone represents a significant compound within the flavonoid class, with implications for health and disease management.
Formula:C16H12O3
InChI:InChI=1/C16H12O3/c1-10-7-12(17)8-15-16(10)13(18)9-14(19-15)11-5-3-2-4-6-11/h2-9,17H,1H3
SMILES:Cc1cc(cc2c1c(=O)cc(c1ccccc1)o2)O
Synonyms:- Hydroxy-5-Methylflavone, 7-
- 7-hydroxy-5-methyl-2-phenyl-4H-chromen-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Hydroxy-5-methylflavone
CAS:7-Hydroxy-5-methylflavone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C16H12O3Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:252.284H-1-Benzopyran-4-one,7-hydroxy-5-methyl-2-phenyl-
CAS:Formula:C16H12O3Purity:90%Molecular weight:252.26477-Hydroxy-5-methylflavon
CAS:7-Hydroxy-5-methylflavon is a natural product for research related to life sciences. The catalog number is TN3233 and the CAS number is 15235-99-1.Formula:C16H12O3Purity:98%Color and Shape:SolidMolecular weight:252.267-Hydroxy-5-methylflavone
CAS:<p>7-Hydroxy-5-methylflavone is a flavonoid compound, which is a diverse group of phytonutrients present in a variety of plants. These compounds are derived from flavonoid biosynthesis pathways that commonly occur in fruits, vegetables, and certain beverages like tea. Flavonoids are well-regarded for their roles in plant defense mechanisms and their antioxidative properties.</p>Formula:C16H12O3Purity:Min. 95%Color and Shape:PowderMolecular weight:252.26 g/mol



