
CAS 1523541-92-5
:Oxazolo[5,4-c]pyridin-2(1H)-one, hexahydro-1-methyl-, hydrochloride (1:1), (3aR,7aS)-
Description:
Oxazolo[5,4-c]pyridin-2(1H)-one, hexahydro-1-methyl-, hydrochloride (1:1), (3aR,7aS)- is a chemical compound characterized by its unique bicyclic structure, which incorporates both oxazole and pyridine moieties. This compound features a hexahydro-1-methyl group, indicating the presence of a saturated cyclic structure with a methyl substituent. The hydrochloride form suggests that the compound is a salt, which enhances its solubility in water and may influence its pharmacological properties. The stereochemistry denoted by (3aR,7aS) indicates specific spatial arrangements of atoms, which can significantly affect the compound's biological activity and interactions with receptors. Typically, compounds of this nature are investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The presence of both nitrogen and oxygen heteroatoms in the structure may contribute to its reactivity and ability to form hydrogen bonds, which are crucial for biological interactions. Overall, this compound represents a class of heterocyclic compounds that are of interest in various chemical and pharmaceutical research contexts.
Formula:C7H12N2O2·ClH
InChI:InChI=1S/C7H12N2O2.ClH/c1-9-5-2-3-8-4-6(5)11-7(9)10;/h5-6,8H,2-4H2,1H3;1H/t5-,6+;/m0./s1
InChI key:InChIKey=IUCKOFCDGFHQOH-RIHPBJNCSA-N
SMILES:CN1[C@@]2([C@](OC1=O)(CNCC2)[H])[H].Cl
Synonyms:- Oxazolo[5,4-c]pyridin-2(1H)-one, hexahydro-1-methyl-, hydrochloride (1:1), (3aR,7aS)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3Ar,7as)-1-methyl-octahydro-[1,3]oxazolo[5,4-c]pyridin-2-one hydrochloride
CAS:Formula:C7H13ClN2O2Molecular weight:192.6433
