CymitQuimica logo

CAS 1523541-98-1

:

Piperazine, 2,6-dimethyl-, (2R,6R)-, ethanedioate (1:1)

Description:
Piperazine, 2,6-dimethyl-, (2R,6R)-, ethanedioate (1:1) is a chemical compound characterized by its piperazine backbone, which is a six-membered ring containing two nitrogen atoms. The specific stereochemistry indicated by (2R,6R) suggests that the compound has defined spatial arrangements at the 2 and 6 positions of the piperazine ring, which can influence its biological activity and interactions. The ethanedioate component refers to the presence of oxalic acid (ethanedioic acid) in its salt form, which contributes to the compound's solubility and stability in various solvents. This compound may exhibit properties typical of piperazine derivatives, such as potential pharmacological effects, including anxiolytic or antidepressant activities, due to its ability to interact with neurotransmitter systems. Its applications could extend to medicinal chemistry, where it may serve as a lead compound for drug development. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C6H14N2·C2H2O4
InChI:InChI=1S/C6H14N2.C2H2O4/c1-5-3-7-4-6(2)8-5;3-1(4)2(5)6/h5-8H,3-4H2,1-2H3;(H,3,4)(H,5,6)/t5-,6-;/m1./s1
InChI key:InChIKey=SGDBJISJUXHDLI-KGZKBUQUSA-N
SMILES:C[C@H]1N[C@H](C)CNC1.C(C(O)=O)(O)=O
Synonyms:
  • Piperazine, 2,6-dimethyl-, (2R,6R)-, ethanedioate (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.