CAS 1523571-12-1
:Phenylmethyl N-[(tetrahydro-2H-pyran-3-yl)methyl]carbamate
Description:
Phenylmethyl N-[(tetrahydro-2H-pyran-3-yl)methyl]carbamate, identified by its CAS number 1523571-12-1, is a chemical compound characterized by its carbamate functional group, which is known for its applications in pharmaceuticals and agrochemicals. The structure features a phenylmethyl group, contributing to its aromatic properties, and a tetrahydro-2H-pyran moiety, which introduces a cyclic ether component that can influence the compound's solubility and reactivity. This compound may exhibit specific biological activities due to its unique structural features, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the carbamate linkage, which can participate in hydrogen bonding and other intermolecular forces. Additionally, the stereochemistry of the tetrahydro-pyran ring can affect the compound's conformational flexibility and overall stability. Overall, the characteristics of this compound suggest potential utility in various chemical applications, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C14H19NO3
InChI:InChI=1S/C14H19NO3/c16-14(15-9-13-7-4-8-17-10-13)18-11-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,15,16)
InChI key:InChIKey=PEHYIKIUPOKBDC-UHFFFAOYSA-N
SMILES:C(NC(OCC1=CC=CC=C1)=O)C2CCCOC2
Synonyms:- Carbamic acid, N-[(tetrahydro-2H-pyran-3-yl)methyl]-, phenylmethyl ester
- Phenylmethyl N-[(tetrahydro-2H-pyran-3-yl)methyl]carbamate
- Benzyl ((tetrahydro-2H-pyran-3-yl)methyl)carbamate
- benzyl N-(oxan-3-ylmethyl)carbamate - [B27913]
- 3-(N-CBZ-AMinoMethyl)tetrahydropyran
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
