CymitQuimica logo

CAS 1523606-22-5

:

5-Azaspiro[3.4]octane-2-carboxylic acid, hydrochloride (1:1)

Description:
5-Azaspiro[3.4]octane-2-carboxylic acid, hydrochloride (1:1) is a chemical compound characterized by its spirocyclic structure, which features a nitrogen atom incorporated into a bicyclic framework. This compound typically exhibits properties associated with both carboxylic acids and amines due to the presence of the carboxylic acid functional group and the nitrogen atom. As a hydrochloride salt, it is likely to be soluble in water, which is a common characteristic of many hydrochloride salts, enhancing its potential for biological activity. The spiro structure may contribute to unique steric and electronic properties, influencing its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity stemming from its structural features. However, specific applications and biological effects would require further investigation through experimental studies.
Formula:C8H13NO2·ClH
InChI:InChI=1S/C8H13NO2.ClH/c10-7(11)6-4-8(5-6)2-1-3-9-8;/h6,9H,1-5H2,(H,10,11);1H
InChI key:InChIKey=RXWBXEUCKHQFRH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CC2(C1)CCCN2.Cl
Synonyms:
  • 5-Azaspiro[3.4]octane-2-carboxylic acid, hydrochloride (1:1)
Found 3 products.