CAS 1523606-34-9

2-Pyrrolidinecarbonitrile, 2,2,2-trifluoroacetate (1:1)

Description:

2-Pyrrolidinecarbonitrile, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its unique structural features and functional groups. It consists of a pyrrolidine ring, which is a five-membered cyclic amine, and a carbonitrile group, indicating the presence of a cyano functional group (-C≡N). The trifluoroacetate moiety introduces significant electronegativity due to the presence of three fluorine atoms attached to the acetyl group, enhancing the compound's reactivity and solubility in polar solvents. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity of the substance. Safety data should be consulted, as the presence of the trifluoroacetate group may impart specific hazards, including toxicity and environmental concerns. Overall, 2-Pyrrolidinecarbonitrile, 2,2,2-trifluoroacetate is a versatile compound with applications in various fields of chemistry.

Formula: C₅H₈N₂·C₂HF₃O₂

InChI: InChI=1S/C5H8N2.C2HF3O2/c6-4-5-2-1-3-7-5;3-2(4,5)1(6)7/h5,7H,1-3H2;(H,6,7)

InChI key: InChIKey=QROMHLFLMYDBEQ-UHFFFAOYSA-N

SMILES: C(#N)C1CCCN1.C(C(O)=O)(F)(F)F

Synonyms:

• 2-Pyrrolidinecarbonitrile, 2,2,2-trifluoroacetate (1:1)

2-Cyanopyrrolidine tfa

CAS: 1523606-34-9

Formula: C₇H₉F₃N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 210.1538

Ref: IN-DA00HY0K

2-Cyanopyrrolidinium trifluoroacetate

CAS: 1523606-34-9

2-Cyanopyrrolidinium trifluoroacetate

Molecular weight: 210.15377g/mol

Ref: 54-PC107051

2-CYANOPYRROLIDINE TFA

CAS: 1523606-34-9

Formula: C₇H₉F₃N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 210.156

Ref: 10-F467435

2-Cyanopyrrolidine Trifuloracetic Acid

CAS: 1523606-34-9

2-Cyanopyrrolidine Trifluoroacetic Acid is a research chemical with various characteristics and applications. It is known to have bioavailability and acts as an inhibitor for certain enzymes. This compound has been studied for its potential use in acidosis treatment and as a phosphatase inhibitor. Additionally, it has shown to affect the viscosity of solutions containing 2-deoxy-l-ribose and piperazine. Furthermore, 2-Cyanopyrrolidine Trifluoroacetic Acid has been found to interact with receptors such as 5-HT1A, dopamine, and potassium channels. Its unique properties make it an interesting compound for further research in the field of biochemistry and pharmacology.

Formula: C₂HO₂F₃·C₅H₈N₂

Purity: Min. 95%

Molecular weight: 210.15 g/mol

Ref: 3D-YKC60634