CAS 1523618-08-7

1H-Pyrrolo[2,3-b]pyridine-3-methanamine, hydrochloride (1:2)

Description:

1H-Pyrrolo[2,3-b]pyridine-3-methanamine, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. It is often utilized in medicinal chemistry and drug development, particularly in the synthesis of bioactive molecules. The presence of the amine functional group suggests potential reactivity, allowing for further derivatization and modification. Additionally, the compound may exhibit biological activity, making it of interest in pharmacological studies. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Safety data and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₈H₉N₃·2ClH

InChI: InChI=1S/C8H9N3.2ClH/c9-4-6-5-11-8-7(6)2-1-3-10-8;;/h1-3,5H,4,9H2,(H,10,11);2*1H

InChI key: InChIKey=GTMAOWKQICDFAG-UHFFFAOYSA-N

SMILES: C(N)C=1C=2C(NC1)=NC=CC2.Cl

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-3-methanamine, hydrochloride (1:2)

(1H-Pyrrolo[2,3-b]pyridin-3-yl)methanamine dihydrochloride

CAS: 1523618-08-7

Formula: C₈H₁₁Cl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 220.0990

Ref: IN-DA00HY14

1H-Pyrrolo[2,3-b]pyridin-3-ylmethanamine dihydrochloride

CAS: 1523618-08-7

1H-Pyrrolo[2,3-b]pyridin-3-ylmethanamine dihydrochloride

Molecular weight: 220.09904g/mol

Ref: 54-OR1021019

1H-Pyrrolo[2,3-b]pyridin-3-ylmethanamine Dihydrochloride

CAS: 1523618-08-7

Versatile small molecule scaffold

Formula: C₈H₉N₃HCl

Purity: Min. 95%

Molecular weight: 220.09 g/mol

Ref: 3D-YKC61808