CAS 1523618-10-1

Description:

The chemical substance with the CAS number 1523618-10-1 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds identified by CAS numbers can be characterized by their molecular structure, physical properties (such as melting point, boiling point, and solubility), and chemical behavior (including reactivity and stability). Additionally, the compound may have applications in various fields, such as pharmaceuticals, materials science, or agriculture, depending on its functional groups and overall structure. To obtain precise characteristics, including safety data, toxicity, and specific applications, it is advisable to consult specialized chemical databases, scientific literature, or safety data sheets (SDS) that provide comprehensive information on the substance in question.

Formula: C₉H₁₂N₂OS

InChI: InChI=1S/C9H12N2OS/c10-7-1-3-8(4-2-7)13(11,12)9-5-6-9/h1-4,9,11H,5-6,10H2

InChI key: InChIKey=NLKQFDBGCBBXDX-UHFFFAOYSA-N

SMILES: S(=N)(=O)(C1=CC=C(N)C=C1)C2CC2

4-(Cyclopropylsulfonimidoyl)aniline

CAS: 1523618-10-1

Formula: C₉H₁₂N₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 196.2694

Ref: IN-DA0209DJ

4-(Cyclopropylsulfonimidoyl)aniline

CAS: 1523618-10-1

4-(Cyclopropylsulfonimidoyl)aniline

Purity: 98%

Molecular weight: 196.27g/mol

Ref: 54-OR88176

4-(Cyclopropylsulfonimidoyl)aniline

CAS: 1523618-10-1

Purity: 98%

Molecular weight: 196.2700043

Ref: 10-F625339