CAS 1523618-34-9

1-[(4-Methylphenyl)sulfonyl]-4,4-piperidinedimethanol

Description:

1-[(4-Methylphenyl)sulfonyl]-4,4-piperidinedimethanol, identified by its CAS number 1523618-34-9, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The presence of a sulfonyl group attached to a 4-methylphenyl moiety indicates that this compound has both aromatic and sulfonic functionalities, contributing to its potential reactivity and solubility properties. The dimethanol substituents suggest that the compound has two hydroxyl (-OH) groups, which can enhance its hydrogen bonding capabilities, potentially affecting its physical properties such as boiling point and solubility in polar solvents. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. However, specific applications, toxicity, and safety data would require further investigation through empirical studies and literature review. Overall, its unique structure positions it as a compound of interest for various chemical and pharmaceutical applications.

Formula: C₁₄H₂₁NO₄S

InChI: InChI=1S/C14H21NO4S/c1-12-2-4-13(5-3-12)20(18,19)15-8-6-14(10-16,11-17)7-9-15/h2-5,16-17H,6-11H2,1H3

InChI key: InChIKey=SSPZMXLYVPOWNY-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1CCC(CO)(CO)CC1)C2=CC=C(C)C=C2

Synonyms:

• 4,4-Piperidinedimethanol, 1-[(4-methylphenyl)sulfonyl]-
• (1-Tosylpiperidine-4,4-diyl)dimethanol
• 1-[(4-Methylphenyl)sulfonyl]-4,4-piperidinedimethanol
• [4-(hydroxymethyl)-1-(4-methylbenzenesulfonyl)piperidin-4-yl]methanol
• [4-HydroxyMethyl-1-(toluene-4-sulfonyl)-piperidin-4-yl]-Methanol

[4-Hydroxymethyl-1-(toluene-4-sulfonyl)-piperidin-4-yl]-methanol

CAS: 1523618-34-9

Formula: C₁₄H₂₁NO₄S

Molecular weight: 299.3858

Ref: IN-DA00HY1J

[4-HYDROXYMETHYL-1-(TOLUENE-4-SULFONYL)-PIPERIDIN-4-YL]-METHANOL

CAS: 1523618-34-9

Formula: C₁₄H₂₁NO₄S

Purity: 95.0%

Molecular weight: 299.39

Ref: 10-F467578