CymitQuimica logo

CAS 1524-40-9

:

3-FLUOROBENZENESULFONAMIDE

Description:
3-Fluorobenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a fluorinated benzene ring. Its molecular structure features a fluorine atom positioned at the meta position relative to the sulfonamide group on the benzene ring. This compound is typically a white to off-white solid and is soluble in polar solvents, which is a common trait for sulfonamides due to their ability to form hydrogen bonds. 3-Fluorobenzenesulfonamide is of interest in medicinal chemistry and pharmaceutical research, as sulfonamides are known for their antibacterial properties and potential applications in drug development. The presence of the fluorine atom can influence the compound's biological activity and pharmacokinetics, making it a subject of study for enhancing therapeutic efficacy. Additionally, this compound may be utilized in various chemical syntheses and as an intermediate in the production of other chemical entities. Proper handling and safety measures should be observed, as with all chemical substances, due to potential toxicity and environmental impact.
Formula:C6H6FNO2S
InChI:InChI=1/C6H6FNO2S/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H,(H2,8,9,10)
InChI key:CRINBBOGNYCAOV-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)S(=O)(=O)N)F
Synonyms:
  • 3-Fluorobenzenesulphonamide
  • Buttpark 33\11-50
  • Benzenesulfonamide, 3-fluoro- (9CI)
Found 5 products.