CAS 152402-98-7: 2-[[(4-Nitro-3-Methyl-2-Pyridinyl)-2-Methyl]Thio]-1H-Benzimidazole
Description:2-[[(4-Nitro-3-Methyl-2-Pyridinyl)-2-Methyl]Thio]-1H-Benzimidazole, with the CAS number 152402-98-7, is a chemical compound characterized by its complex structure, which includes a benzimidazole core and a pyridine moiety. This compound features a nitro group and a methyl group on the pyridine ring, contributing to its unique chemical properties. The presence of a thioether linkage enhances its reactivity and solubility in various organic solvents. Typically, compounds of this nature exhibit biological activity, making them of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. The molecular structure suggests that it may interact with biological targets through mechanisms such as enzyme inhibition or receptor modulation. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, this compound represents a class of heterocyclic compounds that are valuable in medicinal chemistry and material science.
Formula:C14H12N4O2S
InChI:InChI=1S/C14H12N4O2S/c1-9-12(15-7-6-13(9)18(19)20)8-21-14-16-10-4-2-3-5-11(10)17-14/h2-7H,8H2,1H3,(H,16,17)
InChI key:InChIKey=HLHGTWPLDSUGJJ-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C=CN=C(C1C)CSC2=NC=3C=CC=CC3N2
- Synonyms:
- 1H-Benzimidazole, 2-[[(3-methyl-4-nitro-2-pyridinyl)methyl]thio]-
- 2-[(3-Methyl-4-nitro-2-pyridinyl)methylthio]-1H-benzimidazole
- 2-[[(3-Methyl-4-nitro-2-pyridinyl)methyl]thio]-1H-benzimidazole
- 2-[[(3-Methyl-4-nitro-2-pyridyl)methyl]thio]-1H-benzimidazole
- 2-[[[3-Methyl-4-nitro-2-pyridyl]methyl]thio]benzimidazole
- 2-{[(3-methyl-4-nitropyridin-2-yl)methyl]sulfanyl}-1H-benzimidazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-[[(4-Nitro-3-Methyl-2-Pyridinyl)-2-Methyl]Thio]-1H-Benzimidazole REF: IN-DA00AC65CAS: 152402-98-7 | 98% | 104.00 € | Wed 12 Mar 25 |
![]() | Lansoprazole Impurity 50 REF: 4Z-L-0380CAS: 152402-98-7 | - - - | To inquire | Wed 19 Mar 25 |
![]() | 2-[[[3-Methyl-4-nitro-2-pyridyl]methyl]thio]benzimidazole REF: 3D-CGA40298CAS: 152402-98-7 | Min. 95% | - - - | Discontinued product |

2-[[(4-Nitro-3-Methyl-2-Pyridinyl)-2-Methyl]Thio]-1H-Benzimidazole
Ref: IN-DA00AC65
1g | 104.00 € |

Ref: 4Z-L-0380
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

2-[[[3-Methyl-4-nitro-2-pyridyl]methyl]thio]benzimidazole
Ref: 3D-CGA40298
25g | Discontinued | Request information | |
50g | Discontinued | Request information | |
100g | Discontinued | Request information |