CAS 152504-08-0
:1-(4-chlorophenyl)-3-[N-[6-[(N-cyanocarbamimidoyl)amino]hexyl]carbamimidoyl]guanidine
Description:
1-(4-chlorophenyl)-3-[N-[6-[(N-cyanocarbamimidoyl)amino]hexyl]carbamimidoyl]guanidine, with the CAS number 152504-08-0, is a synthetic organic compound characterized by its complex structure, which includes a guanidine core and multiple functional groups. This compound features a chlorophenyl moiety, which contributes to its hydrophobic characteristics, and a hexyl chain that enhances its solubility in organic solvents. The presence of cyanocarbamimidoyl groups indicates potential reactivity and biological activity, making it of interest in medicinal chemistry. Its guanidine structure suggests possible interactions with biological targets, such as enzymes or receptors, potentially influencing physiological processes. The compound's unique arrangement of atoms and functional groups may impart specific pharmacological properties, which could be explored in drug development. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and applications.
Formula:C16H24ClN9
InChI:InChI=1/C16H24ClN9/c17-12-5-7-13(8-6-12)25-16(21)26-15(20)23-10-4-2-1-3-9-22-14(19)24-11-18/h5-8H,1-4,9-10H2,(H3,19,22,24)(H5,20,21,23,25,26)
SMILES:C(CCCNC(=N)NC(=N)Nc1ccc(cc1)Cl)CCNC(=N)NC#N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Chlorhexidine EP Impurity A
CAS:Formula:C16H24ClN9Color and Shape:Off-White SolidMolecular weight:377.88Chlorhexidine EP Impurity A HCl
CAS:Formula:C16H24ClN9·HClColor and Shape:White To Off-White SolidMolecular weight:377.88 36.46Chlorhexidine Diacetate Impurity A
CAS:Controlled ProductFormula:C16H24ClN9Color and Shape:NeatMolecular weight:377.88Chlorhexidine diacetate impurity A
CAS:Chlorhexidine diacetate impurity A is a high purity, analytical standard for the detection of chlorhexidine diacetate impurities in drug products. Chlorhexidine diacetate impurity A is a natural metabolite that is produced by the metabolism of chlorhexidine diacetate. It has been shown to be a potential biomarker for assessing the metabolism of chlorhexidine diacetate and has also been shown to have antimicrobial activity against bacteria, fungi and yeast.Formula:C16H24ClN9Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:377.88 g/mol



