CAS 152529-79-8
:4-(2,3,6,9-Tetrahydro-2,6-dioxo-1-propyl-1H-purin-8-yl)benzenesulfonic acid
Description:
4-(2,3,6,9-Tetrahydro-2,6-dioxo-1-propyl-1H-purin-8-yl)benzenesulfonic acid, with the CAS number 152529-79-8, is a chemical compound that features a purine derivative structure linked to a benzenesulfonic acid moiety. This compound is characterized by its complex bicyclic structure, which includes a purine ring system that is typically associated with nucleic acids and various biological activities. The presence of the sulfonic acid group contributes to its solubility in water and enhances its potential as a reagent or pharmaceutical intermediate. The compound may exhibit various biological properties, potentially acting as an inhibitor or modulator in biochemical pathways. Its unique structural features suggest that it could interact with specific biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the presence of multiple functional groups may influence its reactivity and stability under different conditions, which is crucial for its applications in research and industry.
Formula:C14H14N4O5S
InChI:InChI=1S/C14H14N4O5S/c1-2-7-18-13(19)10-12(17-14(18)20)16-11(15-10)8-3-5-9(6-4-8)24(21,22)23/h3-6H,2,7H2,1H3,(H,15,16)(H,17,20)(H,21,22,23)
InChI key:InChIKey=UYDRRQPGDSIMNU-UHFFFAOYSA-N
SMILES:O=C1C2=C(N=C(N2)C3=CC=C(S(=O)(=O)O)C=C3)NC(=O)N1CCC
Synonyms:- PSB 1115
- Benzenesulfonic acid, 4-(2,3,6,7-tetrahydro-2,6-dioxo-1-propyl-1H-purin-8-yl)-
- 4-(2,3,6,9-Tetrahydro-2,6-dioxo-1-propyl-1H-purin-8-yl)benzenesulfonic acid
- Benzenesulfonic acid, 4-(2,3,6,9-tetrahydro-2,6-dioxo-1-propyl-1H-purin-8-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(2,3,6,7-TETRAHYDRO-2,6-DIOXO-1-PROPYL-1H-PURIN-8-YL)-BENZENESULFONIC ACID
CAS:Formula:C14H14N4O5SPurity:98%Color and Shape:SolidMolecular weight:350.34984-(2,6-Dioxo-1-propyl-2,3,6,9-tetrahydro-1H-purin-8-yl)benzenesulfonic acid
CAS:4-(2,6-Dioxo-1-propyl-2,3,6,9-tetrahydro-1H-purin-8-yl)benzenesulfonic acidPurity:98%Molecular weight:350.36g/molPSB 1115
CAS:PSB 1115 is a small-molecule compound that has been shown to inhibit the p2 receptor and extracellular adenosine A3 receptor. It is also able to inhibit tumor growth by inhibiting the cancer cell's ability to produce ATP, which is necessary for its survival. PSB 1115 has been shown in animal studies to have anti-inflammatory properties and may be useful in treating bladder inflammation. Furthermore, PSB 1115 has been shown to have high lipophilicity, which allows it to cross the blood-brain barrier more easily than other compounds. This property may make it a promising candidate for the treatment of neurological disorders such as Parkinson's disease and Alzheimer's disease.Formula:C14H14N4O5SPurity:Min. 95%Molecular weight:350.35 g/molPSB 1115
CAS:PSB 1115 is an A2B receptor antagonist and can counteract the inhibitory effect of NECA.Formula:C14H14N4O5SPurity:98.69% - >99.99%Color and Shape:SolidMolecular weight:350.35



