CAS 15253-37-9
:S-carboxymethylthiocysteine
Description:
S-carboxymethylthiocysteine, with the CAS number 15253-37-9, is a derivative of the amino acid cysteine, characterized by the presence of a carboxymethyl group attached to the sulfur atom of the thiol group. This compound is typically recognized for its potential antioxidant properties, which can be attributed to the thiol functionality that allows it to scavenge free radicals. S-carboxymethylthiocysteine is soluble in water, making it suitable for various biochemical applications, including studies related to cellular metabolism and detoxification processes. Its structure contributes to its reactivity, particularly in redox reactions, and it may play a role in the modulation of cellular signaling pathways. Additionally, this compound has been investigated for its potential therapeutic applications, particularly in conditions where oxidative stress is a contributing factor. Overall, S-carboxymethylthiocysteine represents an interesting compound in the field of biochemistry, with implications for health and disease management.
Formula:C5H9NO4S2
InChI:InChI=1/C5H9NO4S2/c6-3(5(9)10)1-11-12-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1
SMILES:C([C@@H](C(=O)O)N)SSCC(=O)O
Synonyms:- S-(Carboxymethylthio)-L-cysteine
- 3-((Carboxymethyl)dithio)-L-alanine
- 3-[(carboxymethyl)disulfanyl]-L-alanine
- S-Carboxymethylthiocysteine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Carbocisteine Impurity 3
CAS:Formula:C5H9NO4S2Color and Shape:White To Off-White SolidMolecular weight:211.25

