CAS 152548-66-8
:Fmoc-N-Me-Asp(OtBu)-OH
Description:
Fmoc-N-Me-Asp(OtBu)-OH, also known as Fmoc-N-methyl aspartic acid with a tert-butyl ester protecting group, is a chemical compound commonly used in peptide synthesis and research. It features a fluorenylmethoxycarbonyl (Fmoc) group, which serves as a protective group for the amino functionality, allowing for selective reactions during peptide assembly. The N-methyl group enhances the compound's lipophilicity and can influence the conformation of peptides. The aspartic acid moiety contributes to the compound's acidic properties, while the tert-butyl ester (OtBu) protects the carboxylic acid group, preventing unwanted reactions during synthesis. This compound is typically utilized in solid-phase peptide synthesis (SPPS) due to its stability and ease of deprotection under mild conditions. Its structural characteristics make it valuable in the development of bioactive peptides and pharmaceuticals. As with many chemical substances, proper handling and storage are essential to maintain its integrity and ensure safety in laboratory environments.
Formula:C24H27NO6
InChI:InChI=1/C24H27NO6/c1-24(2,3)31-21(26)13-20(22(27)28)25(4)23(29)30-14-19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)19/h5-12,19-20H,13-14H2,1-4H3,(H,27,28)/t20-/m0/s1
SMILES:CC(C)(C)OC(=O)C[C@@H](C(=O)O)N(C)C(=O)OCC1c2ccccc2c2ccccc12
Synonyms:- (2S)-4-tert-butoxy-2-{[(9H-fluoren-9-ylmethoxy)carbonyl](methyl)amino}-4-oxobutanoic acid (non-preferred name)
- Fmoc-N-methyl-L-aspartic acid 4-tert-butyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Fmoc-N-Me-Asp(OtBu)-OH
CAS:Bachem ID: 4018551.
Formula:C24H27NO6Purity:98.7%Color and Shape:WhiteMolecular weight:425.48Fmoc-N-Me-Asp(OtBu)-OH
CAS:Fmoc-N-Me-Asp(OtBu)-OH is a synthetic peptide with potential immunosuppressive properties. It has been shown to inhibit the proliferation of human lymphocytes in response to lipopolysaccharides (LPS) and also to suppress the release of cytokines such as IL-1β, IL-6, and TNFα. The effects were dose dependent and could be reversed by the addition of a neutralizing antibody. This peptide can be used as an immunosuppressant in clinical trials that are investigating treatments for myasthenia gravis. Fmoc-N-Me-Asp(OtBu)-OH has been synthesised using chemical synthesis methods from commercially available reagents.Formula:C24H27NO6Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:425.47 g/mol(2S)-4-tert-butoxy-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-butanoic acid
CAS:Purity:95%Molecular weight:425.48





