CAS 152574-10-2
:linusitamarin
Description:
Linusitamarin, with the CAS number 152574-10-2, is a chemical compound that belongs to the class of natural products known as alkaloids. It is derived from certain plant sources and is characterized by its complex molecular structure, which typically includes multiple functional groups that contribute to its biological activity. Linusitamarin has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and antioxidant effects. The compound's solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Additionally, linusitamarin may exhibit specific interactions with biological targets, making it a subject of research for therapeutic applications. Its safety profile and toxicity are also important considerations in the context of its use in pharmaceuticals or as a dietary supplement. Overall, linusitamarin represents a fascinating area of study within natural product chemistry, with ongoing research aimed at elucidating its mechanisms of action and potential benefits.
Formula:C17H22O9
InChI:InChI=1/C17H22O9/c1-23-10-5-9(3-4-13(19)24-2)6-11(7-10)25-17-16(22)15(21)14(20)12(8-18)26-17/h3-7,12,14-18,20-22H,8H2,1-2H3/b4-3+/t12-,14-,15+,16-,17-/m1/s1
Synonyms:- 2-Propenoic acid, 3-(3-(beta-D-glucopyranosyloxy)-5-methoxyphenyl)-, methyl ester, (E)-
- methyl (2E)-3-[3-(beta-D-glucopyranosyloxy)-5-methoxyphenyl]prop-2-enoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Linusitamarin
CAS:Linusitamarin is a new phenylpropanoid glucoside extracted from the defatted meal of flaxseed, Linum usitatissimum.Formula:C17H22O9Color and Shape:SolidMolecular weight:370.35Linusitarnarin
CAS:Linusitarnarin is a dietary supplement derived from flaxseed, which is a plant-based source rich in lignans and dietary fibers. The mode of action involves the conversion of lignans present in flaxseed into enterolignans by intestinal bacteria, which are then absorbed and exert various physiological effects. These enterolignans have been studied for their potential antioxidant properties, influence on hormone metabolism, and modulation of inflammatory responses.Formula:C17H22O9Purity:Min. 95%Molecular weight:370.35 g/mol

