CAS 152608-41-8
:sodium 2-(3-{3-[(5-ethyl-4'-fluoro-2-hydroxybiphenyl-4-yl)oxy]propoxy}-2-propylphenoxy)benzoate
Description:
Sodium 2-(3-{3-[(5-ethyl-4'-fluoro-2-hydroxybiphenyl-4-yl)oxy]propoxy}-2-propylphenoxy)benzoate, identified by its CAS number 152608-41-8, is a complex organic compound characterized by its unique molecular structure, which includes multiple aromatic rings and ether linkages. This compound is a sodium salt, indicating its solubility in water, which is a significant property for applications in various fields, including pharmaceuticals and materials science. The presence of a fluorine atom and hydroxyl groups suggests potential for strong intermolecular interactions, such as hydrogen bonding, which can influence its reactivity and stability. Additionally, the ethyl and propyl substituents contribute to its hydrophobic characteristics, potentially affecting its behavior in biological systems. Overall, this compound's intricate structure and functional groups may confer specific biological activities or properties, making it of interest for further research and application in drug development or as a surfactant.
Formula:C33H32FNaO6
InChI:InChI=1/C33H33FO6.Na/c1-3-9-25-29(12-7-13-30(25)40-31-11-6-5-10-26(31)33(36)37)38-18-8-19-39-32-21-28(35)27(20-22(32)4-2)23-14-16-24(34)17-15-23;/h5-7,10-17,20-21,35H,3-4,8-9,18-19H2,1-2H3,(H,36,37);/q;+1/p-1
Synonyms:- benzoic acid, 2-[3-[3-[(5-ethyl-4'-fluoro-2-hydroxy[1,1'-biphenyl]-4-yl)oxy]propoxy]-2-propylphenoxy]-, sodium salt (1:1)
- Sodium 2-(3-{3-[(5-ethyl-4'-fluoro-2-hydroxybiphenyl-4-yl)oxy]propoxy}-2-propylphenoxy)benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Etalocib sodium
CAS:Etalocib (LY293111) sodium is an orally active leukotriene B4 (LTB4) receptor antagonist with a Ki value of 25 nM for inhibiting [3H]LTB4 binding. It exhibits an IC50 of 20 nM against LTB4-induced calcium mobilization. Additionally, Etalocib sodium can induce apoptosis.Formula:C33H32FNaO6Color and Shape:SolidMolecular weight:566.59
