CAS 152628-00-7
:2-N-propyl-4-methyl-6-(1-methoxycarbonyl)-benzimidazole Hydrochloride
Description:
2-N-propyl-4-methyl-6-(1-methoxycarbonyl)-benzimidazole hydrochloride is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing a fused benzene and imidazole ring. This compound features a propyl group and a methyl group at specific positions on the benzene ring, contributing to its hydrophobic characteristics. The presence of a methoxycarbonyl group enhances its solubility and reactivity, making it suitable for various applications in medicinal chemistry. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical formulations. The compound may exhibit biological activity, potentially serving as a lead compound in drug development. Its specific interactions and mechanisms of action would depend on further studies, including pharmacological evaluations. Overall, this compound represents a class of heterocyclic compounds that are of interest in the development of therapeutic agents.
Formula:C13H16N2O2
InChI:InChI=1/C13H16N2O2/c1-4-5-11-14-10-7-9(13(16)17-3)6-8(2)12(10)15-11/h6-7H,4-5H2,1-3H3,(H,14,15)
SMILES:CCCc1nc2cc(cc(C)c2[nH]1)C(=O)OC
Synonyms:- Methyl 4-Methyl-2-Propyl-1H-benzimidazole-6-Carboxylate
- 7-methyl-2-PROPYL-1H-Benzoimidazole-5-Carboxylic acid methyl ester
- Methyl 4-Methyl-2-Propyl-1H-Benzoimidazole-5-Carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 7-methyl-2-propyl-1H-benzo[d]imidazole-5-carboxylate
CAS:Formula:C13H16N2O2Purity:98%Color and Shape:SolidMolecular weight:232.2783Methyl 7-methyl-2-propyl-1H-benzo[d]imidazole-5-carboxylate
CAS:Methyl 7-methyl-2-propyl-1H-benzo[d]imidazole-5-carboxylatePurity:98%Molecular weight:232.28g/molMethyl 7-methyl-2-propyl-1H-benzo[d]imidazole-5-carboxylate
CAS:Formula:C13H16N2O2Purity:95.0%Molecular weight:232.2834-Methyl-2-propyl-1H-benzimidazole-6-carboxylic Acid Methyl Ester
CAS:Controlled ProductApplications 4-Methyl-2-propyl-1H-benzimidazole-6-carboxylic Acid Methyl Ester is an intermediate in the synthesis of Telmisartan (T017000), an angiotensin II receptor antagonist.
References Ries, U.J., et al.: J. Med. Chem., 36, 4040 (1993); Yang, L.C., et al.: J. Heterocycles. Chem., 40, 1107 (2003);Formula:C13H16N2O2Color and Shape:NeatMolecular weight:232.28




