CAS 152633-54-0

5-methyl-6-pyridin-4-yl-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one

Description:

5-Methyl-6-pyridin-4-yl-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one is a heterocyclic compound characterized by its complex bicyclic structure, which includes both imidazole and pyridine rings. This compound features a methyl group at the 5-position and a pyridine moiety at the 6-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of nitrogen atoms in its structure, which can engage in hydrogen bonding. The compound is of interest in medicinal chemistry, potentially serving as a scaffold for the development of pharmaceuticals, particularly in the context of targeting specific biological pathways. Its CAS number, 152633-54-0, allows for precise identification in chemical databases. The presence of multiple nitrogen atoms suggests potential basicity, and the compound may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, its structural features and functional groups make it a candidate for further research in drug development and related fields.

Formula: C₁₂H₁₀N₄O

InChI: InChI=1/C12H10N4O/c1-7-9(8-2-4-13-5-3-8)6-10-11(14-7)16-12(17)15-10/h2-6H,1H3,(H2,14,15,16,17)

SMILES: Cc1c(cc2c(n1)[nH]c(n2)O)c1ccncc1

Synonyms:

• 4H-imidazo[4,5-b]pyridin-2-ol, 5-methyl-6-(4-pyridinyl)-
• 5-methyl-6-(pyridin-4-yl)-4H-imidazo[4,5-b]pyridin-2-ol

Win-62005

CAS: 152633-54-0

Win-62005 is an inhibitor of cyclic AMP phosphodiesterase III (PDE III)(Kis: 25 and 26 nM for rat heart and canine aorta).

Formula: C₁₂H₁₀N₄O

Purity: 98%

Color and Shape: Solid

Molecular weight: 226.23

Ref: TM-T13340