CAS 15265-28-8
:palitantin
Description:
Palitantin, with the CAS number 15265-28-8, is a chemical compound that belongs to the class of natural products known as alkaloids. It is primarily derived from certain plant sources and is characterized by its complex molecular structure, which typically includes multiple functional groups that contribute to its biological activity. Palitantin is known for its potential pharmacological properties, including antimicrobial and anti-inflammatory effects, making it of interest in medicinal chemistry and pharmacology. The compound's solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and temperature. Additionally, palitantin may exhibit specific stereochemistry, which can influence its interaction with biological targets. As with many natural products, its extraction and purification can be challenging, requiring sophisticated techniques to isolate it from plant matrices. Overall, palitantin represents a fascinating area of study within the field of natural product chemistry, with ongoing research aimed at elucidating its mechanisms of action and potential therapeutic applications.
Formula:C14H22O4
InChI:InChI=1/C14H22O4/c1-2-3-4-5-6-7-10-8-12(16)14(18)13(17)11(10)9-15/h4-7,10-12,14-16,18H,2-3,8-9H2,1H3/b5-4+,7-6+/t10-,11+,12-,14-/m1/s1
Synonyms:- Nsc 246119
- Cyclohexanone, 3-(1,3-heptadienyl)-5,6-dihydroxy-2-(hydroxymethyl)-, (2alpha,3beta(1E,3E),5alpha,6alpha)-
- (2R,3S,5R,6R)-3-[(1E,3E)-hepta-1,3-dien-1-yl]-5,6-dihydroxy-2-(hydroxymethyl)cyclohexanone
- Palitantin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Palitantin
CAS:Palitantin is a useful organic compound for research related to life sciences. The catalog number is T125757 and the CAS number is 15265-28-8.Formula:C14H22O4Color and Shape:SolidMolecular weight:254.326
