CAS 15267-95-5
:(Chloromethyl)triethoxysilane
Description:
(Chloromethyl)triethoxysilane, with the CAS number 15267-95-5, is an organosilicon compound characterized by the presence of a chloromethyl group and three ethoxy groups attached to a silicon atom. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the chloromethyl group, which can participate in nucleophilic substitution reactions. It is often used as a silane coupling agent, enhancing the adhesion between organic materials and inorganic substrates, making it valuable in various applications, including coatings, adhesives, and sealants. The ethoxy groups contribute to its solubility in organic solvents, while the chloromethyl group allows for further functionalization. Additionally, (Chloromethyl)triethoxysilane can hydrolyze in the presence of moisture, leading to the formation of silanol groups, which can further condense to form siloxane networks. Safety precautions are necessary when handling this compound, as it can be irritating to the skin and eyes, and proper storage conditions should be maintained to prevent degradation.
Formula:C7H17ClO3Si
InChI:InChI=1S/C7H17ClO3Si/c1-4-9-12(7-8,10-5-2)11-6-3/h4-7H2,1-3H3
InChI key:InChIKey=ZDOBWJOCPDIBRZ-UHFFFAOYSA-N
SMILES:[Si](OCC)(OCC)(OCC)CCl
Synonyms:- (Triethoxysilyl)methyl chloride
- Chemos 5612
- Chloromethyltriethoxysilane
- Nd 41
- Nq 5151
- Sic 2298.4
- Silane, (chloromethyl)triethoxy-
- Triethoxy(chloromethyl)silane
- (Chloromethyl)triethoxysilane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(Chloromethyl)triethoxysilane
CAS:Formula:C7H17ClO3SiPurity:>95.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:212.75(CHLOROMETHYL)TRIETHOXYSILANE
CAS:Formula:C7H17ClO3SiPurity:96%Color and Shape:LiquidMolecular weight:212.7466(Chloromethyl)Triethoxysilane
CAS:(Chloromethyl)TriethoxysilanePurity:96%Molecular weight:212.75g/molCHLOROMETHYLTRIETHOXYSILANE
CAS:<p>Halogen Functional Trialkoxy Silane<br>Silane coupling agents have the ability to form a durable bond between organic and inorganic materials to generate desired heterogeneous environments or to incorporate the bulk properties of different phases into a uniform composite structure. The general formula has two classes of functionality. The hydrolyzable group forms stable condensation products with siliceous surfaces and other oxides such as those of aluminum, zirconium, tin, titanium, and nickel. The organofunctional group alters the wetting or adhesion characteristics of the substrate, utilizes the substrate to catalyze chemical transformations at the heterogeneous interface, orders the interfacial region, or modifies its partition characteristics, and significantly effects the covalent bond between organic and inorganic materials.<br>Chloromethyltriethoxysilane; triethoxy(chloromethyl)silane; (chloromethyl)triethoxysilane; (triethoxysilyl)methylchloride<br>Grignard reacts with chlorosilanes or intermolecularly to form carbosilanesUsed in microparticle surface modification<br></p>Formula:C7H17ClO3SiPurity:97%Color and Shape:LiquidMolecular weight:212.75(Chloromethyl)triethoxysilane
CAS:<p>S04415 - (Chloromethyl)triethoxysilane</p>Formula:C7H17ClO3SiPurity:95%Color and Shape:Liquid, Clear LiquidMolecular weight:212.75




