CymitQuimica logo

CAS 1527-61-3

:

N1-(4-isopropylphenyl)-2-chloroacetamide

Description:
N1-(4-isopropylphenyl)-2-chloroacetamide, with the CAS number 1527-61-3, is an organic compound characterized by its amide functional group, which is derived from chloroacetic acid and an isopropyl-substituted phenyl group. This compound typically appears as a solid at room temperature and is known for its moderate solubility in organic solvents, while exhibiting limited solubility in water due to its hydrophobic isopropyl group. The presence of the chlorine atom in the acetamide structure contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of analgesics or anti-inflammatory agents, owing to the structural similarities with known bioactive compounds. Safety data indicates that, like many amides, it should be handled with care, as it may pose health risks upon exposure. Proper storage conditions and handling protocols are essential to ensure safety and stability.
Formula:C11H14ClNO
InChI:InChI=1/C11H14ClNO/c1-8(2)9-3-5-10(6-4-9)13-11(14)7-12/h3-6,8H,7H2,1-2H3,(H,13,14)
InChI key:NBPOAZHKOZEYOV-UHFFFAOYSA-N
SMILES:CC(C)c1ccc(cc1)NC(=O)CCl
Synonyms:
  • 2-chloro-N-[4-(propan-2-yl)phenyl]acetamide
Found 4 products.