CymitQuimica logo

CAS 152714-08-4

:

3-(3-Chlorophenyl)cyclobutanone

Description:
3-(3-Chlorophenyl)cyclobutanone is an organic compound characterized by its cyclobutanone structure, which features a four-membered carbon ring with a ketone functional group. The presence of a 3-chlorophenyl group indicates that a chlorinated phenyl ring is attached to the cyclobutanone at the third position, influencing its chemical properties and reactivity. This compound typically exhibits a solid state at room temperature and is likely to be soluble in organic solvents due to its hydrophobic nature. The chlorophenyl substituent can enhance the compound's biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various chemical syntheses and as an intermediate in the production of more complex molecules. Additionally, the presence of the chlorine atom may impart unique electronic properties, affecting its reactivity and interaction with other chemical species. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.
Formula:C10H9ClO
InChI:InChI=1S/C10H9ClO/c11-9-3-1-2-7(4-9)8-5-10(12)6-8/h1-4,8H,5-6H2
InChI key:InChIKey=MPIYPDUURJOKRP-UHFFFAOYSA-N
SMILES:O=C1CC(C1)C2=CC(Cl)=CC=C2
Synonyms:
  • Cyclobutanone, 3-(3-chlorophenyl)-
  • 3-(3-Chlorophenyl)cyclobutanone
Found 3 products.