CAS 1527503-23-6: 1-(4-Hydroxy-5-methoxy-2-nitrophenyl)cyclobutanecarbonitrile

Description: 1-(4-Hydroxy-5-methoxy-2-nitrophenyl)cyclobutanecarbonitrile is a chemical compound characterized by its unique structural features, including a cyclobutane ring and a nitrile functional group. The presence of a hydroxyl group and a methoxy group on the aromatic ring contributes to its potential reactivity and solubility properties. The nitro group introduces electron-withdrawing characteristics, which can influence the compound's electronic properties and reactivity in various chemical reactions. This compound may exhibit biological activity due to its complex structure, making it of interest in medicinal chemistry and pharmacology. Its molecular interactions could be significant in drug design, particularly in targeting specific biological pathways. Additionally, the compound's stability, solubility, and reactivity can be affected by environmental factors, making it essential to consider these aspects in practical applications. Overall, 1-(4-Hydroxy-5-methoxy-2-nitrophenyl)cyclobutanecarbonitrile represents a fascinating subject for further research in both synthetic and applied chemistry contexts.

Formula: C₁₂H₁₂N₂O₄

InChI: InChI=1S/C12H12N2O4/c1-18-11-5-8(12(7-13)3-2-4-12)9(14(16)17)6-10(11)15/h5-6,15H,2-4H2,1H3

InChI key: InChIKey=BCLXURONCZIUIK-UHFFFAOYSA-N

SMILES: N#CC1(C2=CC(OC)=C(O)C=C2N(=O)=O)CCC1

1-(4-Hydroxy-5-methoxy-2-nitrophenyl)cyclobutanecarbonitrile

CAS: 1527503-23-6

• Formula: C₁₂H₁₂N₂O₄
• Molecular weight: 248.2347

1-(4-Hydroxy-5-methoxy-2-nitrophenyl)cyclobutane-1-carbonitrile

CAS: 1527503-23-6

• Purity: 95+%
• Molecular weight: 248.23800659179688

1-(4-Hydroxy-5-methoxy-2-nitrophenyl)-cyclobutanecarbonitrile

CAS: 1527503-23-6

Please enquire for more information about 1-(4-Hydroxy-5-methoxy-2-nitrophenyl)-cyclobutanecarbonitrile including the price, delivery time and more detailed …

• Formula: C₁₂H₁₂N₂O₄
• Purity: Min. 95%
• Molecular weight: 248.23 g/mol