CAS 15280-57-6
:Acetic acid, erbium(3+) salt, tetrahydrate
Description:
Acetic acid, erbium(3+) salt, tetrahydrate, with the CAS number 15280-57-6, is a coordination compound formed from erbium ions and acetic acid. This substance typically appears as a crystalline solid and is characterized by its solubility in water due to the presence of the tetrahydrate form, which indicates that it contains four molecules of water for each formula unit. The erbium ion, a rare earth element, contributes to the compound's unique properties, including potential applications in materials science and photonics due to its luminescent characteristics. The presence of acetic acid in the structure suggests that the compound may exhibit acidic properties, although it is generally less acidic than free acetic acid. The tetrahydrate form indicates that the compound can participate in hydration reactions, which may influence its stability and reactivity in various environments. Overall, this compound is of interest in both academic research and potential industrial applications, particularly in fields involving rare earth elements and their compounds.
Formula:C2H4O2ErH2O
InChI:InChI=1S/C2H4O2.Er.H2O/c1-2(3)4;;/h1H3,(H,3,4);;1H2
InChI key:InChIKey=QAQFFEKZJRJDCM-UHFFFAOYSA-N
SMILES:C(C)(O)=O.[Er].O
Synonyms:- Acetate, Erbium Salt, Hydrate (1:1:4)
- Acetic acid, erbium(3+) salt, tetrahydrate
- Erbium Triacetate
- Erbium acetate tetrahydrate
- Erbium iii acetate tetrahydrate
- Erbium triacetate tetrahydrate
- Erbium(III) acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Erbium(III) acetate tetrahydrate, 99% (REO)
CAS:<p>Erbium(III) acetate tetrahydrate is used for laboratory reagent, optical glasses, structural ceramics, catalysts, electrical components, photo-optical material and optical fiber. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentati</p>Formula:C6H9ErO6•4H2OPurity:99%Molecular weight:416.45 (344.39anhy)Erbium(III) acetate tetrahydrate, REacton™, 99.9% (REO)
CAS:<p>Erbium(III) acetate tetrahydrate participates in the synthesis and determination of crystal structures and stereochemical properties of lanthanide(III) complexes with ethylenediamine-N,N,N?,N?-tetraacetate. Participates in simple one-pot single-step synthesis of rare earth doped spherical mesoporous</p>Formula:C6H9ErO6•4H2OPurity:99.9%Molecular weight:416.45 (344.39anhy)Erbium(III) acetate hydrate (99.9%-Er) (REO)
CAS:<p>Erbium(III) acetate hydrate (99.9%-Er) (REO)</p>Formula:Er(OOCCH3)3·XH2OPurity:(99.9%-Er)Color and Shape:pink xtl.Molecular weight:344.44


