CAS 15280-58-7
:ytterbium(iii) acetate hydrate
Description:
Ytterbium(III) acetate hydrate is a chemical compound that consists of ytterbium, a rare earth element, combined with acetate ions and water molecules. It typically appears as a white to off-white crystalline solid. The compound is characterized by its hygroscopic nature, meaning it can absorb moisture from the environment. Ytterbium(III) acetate hydrate is soluble in water and polar organic solvents, which facilitates its use in various chemical applications, including as a precursor in the synthesis of ytterbium-containing materials and in coordination chemistry. The presence of the ytterbium ion, which has a +3 oxidation state, contributes to its unique optical and electronic properties, making it of interest in fields such as materials science and photonics. Additionally, the compound may exhibit luminescent properties, which can be harnessed in various technological applications. Safety precautions should be observed when handling this compound, as with many rare earth compounds, due to potential health risks associated with exposure.
Formula:C2H6O3Yb
InChI:InChI=1/C2H4O2.H2O.Yb/c1-2(3)4;;/h1H3,(H,3,4);1H2;
SMILES:CC(=O)O.O.[Yb]
Synonyms:- Ytterbium(iii) acetate tetrahydrate
- Ytterbium Acetate Hydrate
- Ytterbium Acetate Tetrahydrate
- Ytterbium(3+) Triacetate
- Ytterbium - Acetic Acid (1:1) Hydrate
- Ytterbium acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ytterbium(III) acetate hydrate, REacton™, 99.9% (REO)
CAS:<p>Yttrium Acetate is widely applied in electronic ceramics, glass, and electronics. Yttrium compounds are used as a catalyst for ethylene polymerization. Yttrium is used in the production of a large variety of synthetic garnets, and Yttria is used to make Yttrium Iron Garnets, which are very effectiv</p>Formula:C6H9O6YbPurity:99.9%Molecular weight:350.18Ytterbium(III) acetate hydrate (99.9%-Yb) (REO)
CAS:<p>Ytterbium(III) acetate hydrate (99.9%-Yb) (REO)</p>Formula:Yb(OOCCH3)3·XH2OPurity:(99.9%-Yb)Color and Shape:white pwdr.Molecular weight:350.24Ytterbium(III) acetate tetrahydrate
CAS:<p>Ytterbium(III) acetate tetrahydrate</p>Purity:99.9%Color and Shape:PowderMolecular weight:422.23g/mol



