
CAS 152833-54-0
:3-Oxo-N-(tetrahydro-2-oxo-3-furanyl)dodecanamide
Description:
3-Oxo-N-(tetrahydro-2-oxo-3-furanyl)dodecanamide, with the CAS number 152833-54-0, is a chemical compound characterized by its amide functional group and a long aliphatic chain. The presence of the tetrahydro-2-oxo-3-furanyl moiety indicates that it contains a furan ring, which contributes to its potential reactivity and biological activity. The compound features a ketone group (3-oxo) that can participate in various chemical reactions, such as nucleophilic additions. Its dodecanamide structure suggests that it has hydrophobic characteristics due to the long carbon chain, which may influence its solubility and interaction with biological membranes. The combination of these functional groups may impart unique properties, making it of interest in fields such as medicinal chemistry and materials science. Overall, this compound's structure suggests potential applications in drug development or as a chemical intermediate, although specific biological activities and applications would require further investigation.
Formula:C16H27NO4
InChI:InChI=1S/C16H27NO4/c1-2-3-4-5-6-7-8-9-13(18)12-15(19)17-14-10-11-21-16(14)20/h14H,2-12H2,1H3,(H,17,19)
InChI key:InChIKey=PHSRRHGYXQCRPU-UHFFFAOYSA-N
SMILES:N(C(CC(CCCCCCCCC)=O)=O)C1C(=O)OCC1
Synonyms:- 3-Oxo-N-(2-oxooxolan-3-yl)dodecanamide
- 3-Oxo-N-(tetrahydro-2-oxo-3-furanyl)dodecanamide
- Dodecanamide, 3-oxo-N-(tetrahydro-2-oxo-3-furanyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
PA Autoinducer
CAS:PA Autoinducer is a Pseudomonas aeruginosa autoinducer.Formula:C16H27NO4Color and Shape:SolidMolecular weight:297.39
