CAS 15286-98-3
:N-Acryloyl-p-aminobenzoic acid
Description:
N-Acryloyl-p-aminobenzoic acid, with the CAS number 15286-98-3, is an organic compound characterized by its functional groups, which include an acryloyl group and an amino group attached to a benzoic acid structure. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It is known for its ability to undergo polymerization, making it useful in various applications, particularly in the synthesis of polymers and copolymers. The presence of the acryloyl group allows for reactions with other monomers, facilitating the formation of cross-linked networks. Additionally, the amino group can participate in further chemical modifications, enhancing its versatility in organic synthesis. N-Acryloyl-p-aminobenzoic acid is often studied for its potential applications in drug delivery systems, coatings, and as a reagent in biochemical assays. Safety considerations should be taken into account when handling this compound, as it may pose risks associated with its reactive nature.
Formula:C10H9NO3
InChI:InChI=1S/C10H9NO3/c1-2-9(12)11-8-5-3-7(4-6-8)10(13)14/h2-6H,1H2,(H,11,12)(H,13,14)
InChI key:InChIKey=MNIDYHCRWJBKLX-UHFFFAOYSA-N
SMILES:N(C(C=C)=O)C1=CC=C(C(O)=O)C=C1
Synonyms:- 4-(Acryloylamino)Benzoic Acid
- 4-Acrylamidobenzoic acid
- 4-[(1-Oxo-2-propen-1-yl)amino]benzoic acid
- Benzoic acid, 4-[(1-oxo-2-propen-1-yl)amino]-
- Benzoic acid, 4-[(1-oxo-2-propenyl)amino]-
- Benzoic acid, p-acrylamido-
- N-Acryloyl-p-aminobenzoic acid
- p-Acrylamidobenzoic acid
- p-((1-Oxoallyl)amino)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-(Prop-2-enamido)benzoic acid
CAS:<p>4-(Prop-2-enamido)benzoic acid is an antimicrobial agent that is used in the synthesis of polymers. 4-(Prop-2-enamido)benzoic acid reacts with ammonium persulfate to form a monomer which can be polymerized with other compounds such as dioxane. The reaction time and activation energy for this compound are determined by the type of solvent used. This compound is biodegradable and has been shown to be easily copolymerized with other substances. <br>4-(Prop-2-enamido)benzoic acid is soluble in water, dioxane, and dimethylformamide (DMF). It also has a high refractive index under ultraviolet light microscopy when gelatinized. The molecular weight of this compound increases when it is heated due to water loss, but it does not change when it is cooled down or mixed with other chemicals. <br>4-(Prop-2-</p>Formula:C10H9NO3Purity:Min. 95%Molecular weight:191.18 g/mol
