CAS 152881-18-0
:8-(3,4-dimethoxyphenyl)-7-methyl-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione
Description:
The chemical substance known as 8-(3,4-dimethoxyphenyl)-7-methyl-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione, with the CAS number 152881-18-0, is a purine derivative characterized by its complex structure that includes a purine core substituted with various functional groups. This compound features a 3,4-dimethoxyphenyl group at the 8-position and two propyl groups at the 1 and 3 positions, along with a methyl group at the 7-position. The presence of methoxy groups contributes to its potential solubility and reactivity, while the purine structure is significant in biological systems, often relating to nucleic acids and energy transfer molecules like ATP. The compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its specific properties, such as melting point, solubility, and biological activity, would require empirical investigation to fully characterize its behavior in various environments.
Formula:C20H26N4O4
InChI:InChI=1/C20H26N4O4/c1-6-10-23-18-16(19(25)24(11-7-2)20(23)26)22(3)17(21-18)13-8-9-14(27-4)15(12-13)28-5/h8-9,12H,6-7,10-11H2,1-5H3
Synonyms:- 8-(3,4-Dimethoxyphenyl)-3,7-dihydro-7-methyl-1,3-dipropyl-1H-purine-2,6-dione
- 1H-Purine-2,6-dione, 8-(3,4-dimethoxyphenyl)-3,7-dihydro-7-methyl-1,3-dipropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
KF 17837S
CAS:KF 17837S is an adenosine A(2a) receptor antagonists.Formula:C20H26N4O4Color and Shape:SolidMolecular weight:386.44
