CAS 1529-40-4
:9H-Fluorene-9-carbonitrile
Description:
9H-Fluorene-9-carbonitrile, with the CAS number 1529-40-4, is an organic compound characterized by its structure, which consists of a fluorene moiety with a cyano group (-C≡N) attached to the 9-position. This compound typically appears as a white to light yellow solid and is known for its aromatic properties due to the presence of the fluorene framework. It is relatively stable under standard conditions but can undergo reactions typical of nitriles, such as hydrolysis to form carboxylic acids. The compound is of interest in various fields, including organic synthesis and materials science, particularly for its potential applications in the development of organic semiconductors and fluorescent materials. Its solubility is generally limited in water but may dissolve in organic solvents like ethanol and acetone. As with many nitriles, it may exhibit toxicity, necessitating careful handling and appropriate safety measures during use.
Formula:C14H9N
InChI:InChI=1S/C14H9N/c15-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H
InChI key:InChIKey=CJVMCKCMPQEKPZ-UHFFFAOYSA-N
SMILES:C(#N)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- NSC 126783
- 9-Cyanofluorene
- Fluorene-9-carbonitrile
- 9H-Fluorene-9-carbonitrile
- 9-Fluorenonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
9H-Fluorene-9-carbonitrile
CAS:<p>9H-Fluorene-9-carbonitrile is a nitrate that functions as a growth regulator. It has been shown to inhibit the growth of plants by inhibiting the activity of nucleophilic enzymes and reactive nitrogen species. It is also used as an intermediate for the synthesis of triazole fungicides, which are used in agriculture to control diseases on crops such as wheat, oats, barley, and corn. 9H-Fluorene-9-carbonitrile reacts with carbanions derived from c1-6 alkyl halides or protonated amines to form carbenes. 9H-Fluorene-9-carbonitrile undergoes nucleophilic substitution reactions with electrophiles such as ketones or carboxylic acids at temperatures between 0°C and 100°C. This compound is also used for mechanistic studies on the reaction of carbenes with other molecules containing a carbonyl group.</p>Formula:C14H9NPurity:Min. 95%Molecular weight:191.23 g/mol
