CymitQuimica logo

CAS 152937-04-7

:

2-BROMO-6-FLUOROBENZOTHIAZOLE

Description:
2-Bromo-6-fluorobenzothiazole is a heterocyclic organic compound characterized by the presence of both bromine and fluorine substituents on a benzothiazole ring system. The compound features a fused benzene and thiazole ring, which contributes to its aromatic properties and potential reactivity. The bromine atom is typically located at the 2-position, while the fluorine is at the 6-position of the benzothiazole structure. This substitution pattern can influence the compound's electronic properties, making it useful in various chemical applications, including pharmaceuticals and agrochemicals. The presence of halogens like bromine and fluorine can enhance lipophilicity and biological activity, potentially leading to interesting pharmacological properties. Additionally, benzothiazole derivatives are known for their roles in dye chemistry and as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks. Overall, 2-bromo-6-fluorobenzothiazole is a valuable compound in synthetic organic chemistry with diverse applications.
Formula:C7H3BrFNS
InChI:InChI=1/C7H3BrFNS/c8-7-10-5-2-1-4(9)3-6(5)11-7/h1-3H
InChI key:GIANOUBNTGQAID-UHFFFAOYSA-N
SMILES:c1cc2c(cc1F)sc(Br)n2
Synonyms:
  • 2-Bromo-6-fluoro-1,3-benzothiazole
  • Benzothiazole, 2-Bromo-6-Fluoro-
  • 2-Bromo-6-Fluorobenzo[D]Thiazole
Found 4 products.