CAS 15297-43-5
:2-(tritylsulfanyl)ethanamine
Description:
2-(Tritylsulfanyl)ethanamine, with the CAS number 15297-43-5, is an organic compound characterized by the presence of a trityl group (a phenyl group attached to a carbon) and a sulfanyl (thioether) functional group. This compound features a two-carbon ethyl chain linked to an amine group, which contributes to its basicity and potential reactivity in various chemical reactions. The trityl group enhances the compound's stability and solubility in organic solvents, making it useful in synthetic organic chemistry. The sulfanyl moiety can participate in nucleophilic substitution reactions, allowing for further functionalization. Additionally, the presence of the amine group may facilitate hydrogen bonding, influencing its interactions with other molecules. Overall, 2-(tritylsulfanyl)ethanamine is notable for its unique structural features, which can be exploited in the development of pharmaceuticals, agrochemicals, and other fine chemicals. Its properties make it a valuable intermediate in organic synthesis and a subject of interest in medicinal chemistry.
Formula:C21H21NS
InChI:InChI=1/C21H21NS/c22-16-17-23-21(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17,22H2
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)SCCN
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-(Tritylthio)ethylamine hydrochloride
CAS:Formula:C21H22ClNSPurity:98%Color and Shape:SolidMolecular weight:355.92412-(Tritylthio)ethanamine (hydrochloride)
CAS:2-(Tritylthio)ethanamine (hydrochloride)Purity:98%Molecular weight:355.92g/mol2-Tritylthio-1-ethylamine hydrochloride
CAS:Purity:99.0%Color and Shape:Solid, PowderMolecular weight:355.9200134277344Trt-cysteamine hydrochloride
CAS:Trt-cysteamine hydrochloride is a prodrug that is metabolized to cysteamine in vivo. Cysteamine inhibits the production of tumor necrosis factor (TNF) by binding to its receptor and blocking NF-κB signaling pathways. In vitro models have shown that trt-cysteamine hydrochloride has minimal effects on cells, but when used in vivo, it can inhibit oxidative stress and induce cell death. Trt-cysteamine hydrochloride also binds to molecular targets with disulfide bonds, which may be potential therapeutic targets for cancer treatment.Formula:C21H21NS·HClPurity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:355.92 g/molS-Tritylcysteamine Hydrochloride
CAS:Controlled ProductFormula:C21H21NS·HClColor and Shape:NeatMolecular weight:355.924





