CAS 153-76-4
:Gallamine
Description:
Gallamine, with the CAS number 153-76-4, is a chemical compound classified as a neuromuscular blocking agent. It is primarily used in anesthesia to facilitate muscle relaxation during surgical procedures. Gallamine acts as a competitive antagonist at the neuromuscular junction, blocking the action of acetylcholine on nicotinic receptors at the motor end plate, which leads to muscle paralysis. The compound is characterized by its quaternary ammonium structure, which contributes to its pharmacological properties. Gallamine is typically administered intravenously and has a relatively short duration of action, making it suitable for use in various surgical settings. Its side effects may include cardiovascular effects and potential allergic reactions, necessitating careful monitoring during administration. Additionally, gallamine is known to interact with certain anesthetic agents and may require dosage adjustments in patients with specific medical conditions. Overall, gallamine remains an important agent in the field of anesthesiology, although its use has declined with the introduction of newer neuromuscular blockers.
Formula:C24H45N3O3
InChI:InChI=1S/C24H45N3O3/c1-7-25(8-2)16-19-28-22-14-13-15-23(29-20-17-26(9-3)10-4)24(22)30-21-18-27(11-5)12-6/h13-15H,7-12,16-21H2,1-6H3
InChI key:InChIKey=ICLWTJIMXVISSR-UHFFFAOYSA-N
SMILES:O(CCN(CC)CC)C1=C(OCCN(CC)CC)C=CC=C1OCCN(CC)CC
Synonyms:- Triethylamine, 2,2′′′,2′′′′′′-(v-phenenyltrioxy)tris-
- Gallamine
- 2,2′,2′′-[1,2,3-Benzenetriyltris(oxy)]tris[N,N-diethylethanamine]
- Ethanamine, 2,2′,2′′-[1,2,3-benzenetriyltris(oxy)]tris[N,N-diethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
